Cadmium tetrafluoroborate

Cadmium tetrafluoroboate

Identifiers
CAS Number	14486-19-2 Y
3D model (Jmol)	Interactive image
ECHA InfoCard	100.034.975
PubChem	12886773
InChI InChI=1S/2BF4.Cd/c2*2-1(3,4)5;/q2*-1;+2 Key: NXOFSPIMFJTFSE-UHFFFAOYSA-N
SMILES [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Cd+2]
Properties
Chemical formula	Cd(BF4)2
Molar mass	286.020 g/mol
Appearance	colorless solid crystals very hygroscopic
Odor	odorless
Density	1.60 g/cm3
Solubility in water	very soluble
Solubility	very soluble in alcohol
Hazards
US health exposure limits (NIOSH):
PEL (Permissible)	[1910.1027] TWA 0.005 mg/m3 (as Cd)[1]
REL (Recommended)	Ca[1]
IDLH (Immediate danger)	Ca [9 mg/m3 (as Cd)][1]
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Cadmium tetrafluroborate or cadmium(II) tetrafluroborate is a chemical compound, with the formula Cd(BF₄)₂.^[2]

Preparation

Cadmium tetrafluoroborate is prepared from the reaction between an aqueous solution of fluoroboric acid and cadmium carbonate or cadmium oxide.

Uses

Its primary uses are to prepare electroplating baths for high strength steels where normal cyanide baths cause problems of hydrogen embrittlement.

References